![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01.Overview.pdf | 2024-03-21 14:21 | 5.0M | |
| 01.Overview.pptx | 2024-03-12 09:11 | 11M | |
| 01slides.pdf | 2014-03-14 10:31 | 6.2M | |
| 01slides.pptx | 2012-10-03 14:58 | 12M | |
| 02.Latex.pdf | 2024-03-21 14:15 | 6.5M | |
| 02.Latex.pptx | 2024-03-13 15:58 | 8.6M | |
| 02PaperStructure&tit..> | 2014-03-14 10:31 | 2.4M | |
| 02PaperStructure&tit..> | 2018-07-31 17:59 | 8.0M | |
| 03.AstJournals.pdf | 2024-03-21 14:09 | 14M | |
| 03.AstJournals.pptx | 2024-03-21 14:09 | 20M | |
| 03.Presentation.pdf | 2021-04-13 09:34 | 2.0M | |
| 03abstract.pdf | 2014-03-14 10:31 | 707K | |
| 03abstract.pptx | 2012-12-12 10:30 | 592K | |
| 04.PaperPlan.pdf | 2024-03-21 14:10 | 5.4M | |
| 04.PaperPlan.pptx | 2021-11-05 09:43 | 12M | |
| 04Headings.pdf | 2014-03-14 10:32 | 465K | |
| 04Headings.pptx | 2012-12-12 10:31 | 49K | |
| 05.Title.pdf | 2021-04-13 09:34 | 1.3M | |
| 05Intro.pdf | 2014-03-14 10:32 | 938K | |
| 05Intro.pptx | 2018-07-31 19:41 | 679K | |
| 06.Title.pdf | 2021-04-22 09:38 | 1.3M | |
| 06Visuals.pdf | 2014-03-14 10:32 | 360K | |
| 06Visuals.pptx | 2012-12-12 10:58 | 56K | |
| 07.Abstract.pdf | 2021-04-29 09:41 | 5.7M | |
| 07.Headings.pdf | 2021-05-20 09:38 | 368K | |
| 07.Presentation.pdf | 2024-05-15 14:01 | 3.3M | |
| 07Conclusions.pdf | 2014-03-14 10:33 | 736K | |
| 07Conclusions.pptx | 2014-03-14 10:32 | 564K | |
| 08.Intro.pdf | 2021-06-17 12:06 | 6.6M | |
| 08.Intro.pptx | 2021-05-20 09:35 | 8.2M | |
| 09.Intro.pdf | 2021-12-24 09:29 | 4.7M | |
| 11.Visuals.pdf | 2021-06-17 12:13 | 1.7M | |
| 1011.5973.pdf | 2011-10-05 10:55 | 362K | |
| 20111026_Broad-band_..> | 2011-10-26 15:55 | 1.3M | |
| 20111026_Broad-band_..> | 2011-11-02 00:13 | 1.2M | |
| 20111026_Introductio..> | 2011-10-26 15:55 | 1.2M | |
| 20111221_Optical_Ide..> | 2011-12-21 15:00 | 1.0M | |
| 20111221_Testing_Evo..> | 2011-12-21 15:00 | 1.3M | |
| Amitage2011ARAA Prot..> | 2011-09-14 09:04 | 1.1M | |
| BRC_v1.pdf | 2021-06-02 13:16 | 4.9M | |
| BRCpub.pdf | 2015-01-22 10:19 | 2.0M | |
| BRCreport.pdf | 2021-06-02 13:18 | 111K | |
| Beckwith1990AJ99-924..> | 2005-12-28 13:29 | 3.2M | |
| CJP.pdf | 2011-12-23 17:31 | 108K | |
| Chen201012email.pdf | 2011-10-26 14:52 | 41K | |
| Chiang20111026email.pdf | 2011-10-26 14:46 | 41K | |
| Common English Pitfa..> | 2018-07-25 16:47 | 40K | |
| Death Penalty = Capi..> | 2018-07-18 18:37 | 667K | |
| Eswaraiah2012MNRAS41..> | 2012-10-03 14:56 | 1.0M | |
| Frisch2011ARAA ISM a..> | 2011-09-14 09:08 | 1.9M | |
| HW01.pdf | 2024-03-21 14:01 | 1.8M | |
| HW02.pdf | 2024-03-21 14:01 | 852K | |
| HW03.pdf | 2024-03-21 14:02 | 1.7M | |
| HW04.pdf | 2024-03-21 14:05 | 26K | |
| Headings and Subhead..> | 2011-12-07 15:00 | 49K | |
| IOPscience_.. The As..> | 2012-01-11 14:42 | 65K | |
| LINintroduction.pdf | 2013-01-09 09:01 | 109K | |
| Paper Structure.pptx | 2011-11-30 15:00 | 8.0M | |
| SUintroduction.docx | 2013-01-02 14:07 | 15K | |
| SUintroduction.pdf | 2013-01-02 13:57 | 143K | |
| Schnee2012ApJ745-18 ..> | 2011-12-28 14:57 | 1.2M | |
| Scientific writing- ..> | 2011-11-16 10:31 | 541K | |
| Scientific writing- ..> | 2011-11-16 10:31 | 459K | |
| Scientific writing- ..> | 2011-11-16 10:31 | 416K | |
| Scientific writing- ..> | 2011-11-16 10:31 | 361K | |
| Scientific writing- ..> | 2011-11-16 10:31 | 285K | |
| Scientific writing- ..> | 2011-11-16 10:31 | 224K | |
| Scientific writing_ ..> | 2011-11-30 13:59 | 113K | |
| The_Elements_of_Styl..> | 2011-10-05 10:47 | 121K | |
| Top 10 Pros and Cons..> | 2013-01-09 12:17 | 371K | |
| Williams2011ARAA pro..> | 2011-09-14 09:02 | 1.6M | |
| abstract.pptx | 2011-11-30 00:48 | 592K | |
| apj_raa.docx | 2018-08-01 10:33 | 22K | |
| apj_raa.pdf | 2018-08-01 10:33 | 229K | |
| chinese-english-mist..> | 2011-10-05 10:51 | 64K | |
| conclusions.pptx | 2012-01-11 14:45 | 564K | |
| http___iopscience.io..> | 2012-01-11 14:39 | 46K | |
| intro.pptx | 2011-12-28 13:52 | 682K | |
| pitfalls.pdf | 2021-05-28 10:47 | 359K | |
| pitfalls.pptx | 2012-11-07 18:09 | 51K | |
| sciWriting.htm | 2024-03-21 14:12 | 44K | |
| scientificwriting.zip | 2011-11-16 10:31 | 1.8M | |
| slides.pptx | 2011-11-16 14:51 | 12M | |
| techWriting2018.pdf | 2018-09-28 18:01 | 9.8M | |
| techWriting2018.pptx | 2018-08-07 19:45 | 21M | |
| techwriting.pdf | 2018-07-09 10:36 | 9.3M | |
| visuals.pptx | 2011-12-28 14:54 | 55K | |
| www.dictionary.com.pdf | 2011-10-12 17:08 | 385K | |